Home
Products
Corytuberine
| Product Name | Corytuberine |
| Price: | Inquiry |
| Catalog No.: | CN01213 |
| CAS No.: | 517-56-6 |
| Molecular Formula: | C19H21NO4 |
| Molecular Weight: | 327.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Caltha palustris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1O)c1c(O)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corytuberine is an aporphine alkaloid isolated from Dicranostigma leptopodum. Corytuberine displays cytotoxicity against SMMC-7721 tumor cells[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 529.3±50.0 °C at 760 mmHg |
| Flash Point | 273.9±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 62.16000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8℃ |