Home
Products
Sennidin B
| Product Name | Sennidin B |
| Price: | $351 / 5mg |
| Catalog No.: | CN05999 |
| CAS No.: | 517-44-2 |
| Molecular Formula: | C30H18O10 |
| Molecular Weight: | 538.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Cassia angustifolia. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cccc2c1C(=O)c1c(C2C2c3cccc(c3C(=O)c3c2cc(cc3O)C(=O)O)O)cc(cc1O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sennidin B, a stereoisomer isolated from the leaves of Cassia angustifolia, has lower activity than Sennidin A. Sennidin A inhibits HCV NS3 helicase, with an IC50 of 0.8 μM. Sennidin A induces phosphorylation of Akt and glucose transporter 4 (GLUT4) translocation. Sennidin A stimulates the glucose incorporation [1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 801.8±65.0 °C at 760 mmHg |
| Flash Point | 452.6±30.8 °C |
| Exact Mass | 538.090027 |
| PSA | 189.66000 |
| LogP | 8.24 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |