Home
Products
Hematoxylin
| Product Name | Hematoxylin |
| Price: | $18 / 20mg |
| Catalog No.: | CN04745 |
| CAS No.: | 517-28-2 |
| Molecular Formula: | C16H14O6 |
| Molecular Weight: | 302.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Caesalpinia sappan. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2C[C@@]3([C@H](c2cc1O)c1ccc(c(c1OC3)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hematoxylin is a natural product. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 579.9±50.0 °C at 760 mmHg |
| Flash Point | 304.5±30.1 °C |
| Exact Mass | 302.079041 |
| PSA | 110.38000 |
| LogP | 0.51 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | Store at RT. |