Home
Products
Isoarnebin I
| Product Name | Isoarnebin I |
| Price: | Inquiry |
| Catalog No.: | CN05862 |
| CAS No.: | 5162-01-6 |
| Molecular Formula: | C21H22O6 |
| Molecular Weight: | 370.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The herbs of Lithospermum erythrorhizon |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC(C1=CC(=O)c2c(C1=O)c(O)ccc2O)OC(=O)C=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (Rac)-Arnebin 1 ((Rac)-β,β-Dimethylacrylalkannin) is the racemate of β,β-Dimethylacrylalkannin and/or β,β-Dimethylacrylshikonin. β,β-Dimethylacrylalkannin and β,β-Dimethylacrylshikonin are napthoquinones isolated from Arnebia nobilis. β,β-Dimethylacrylshikonin has anti-tumor activity[1]. |
| Density | 1.269g/cm3 |
| Boiling Point | 587.345 °C |
| Flash Point | 206.409 °C |
| Exact Mass | 370.14200 |
| PSA | 100.90000 |
| LogP | 3.63750 |
| Storage condition | -20°C |