Home
Products
Cerevisterol
| Product Name | Cerevisterol |
| Price: | Inquiry |
| Catalog No.: | CN02508 |
| CAS No.: | 516-37-0 |
| Molecular Formula: | C28H46O3 |
| Molecular Weight: | 430.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1CCC2(C(C1)(O)C(O)C=C1C2CCC2(C1CCC2C(/C=C/C(C(C)C)C)C)C)C C28H46O3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cerevisterol is a steroid isolated from the fruiting bodies of Agaricus blazei[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 535.0±50.0 °C at 760 mmHg |
| Flash Point | 221.2±24.7 °C |
| Exact Mass | 430.344696 |
| PSA | 60.69000 |
| LogP | 7.38 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |