Home
Products
Odonicin
| Product Name | Odonicin |
| Price: | Inquiry |
| Catalog No.: | CN08815 |
| CAS No.: | 51419-51-3 |
| Molecular Formula: | C24H30O7 |
| Molecular Weight: | 430.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Rabdosia longituba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1[C@@H]2C(C)(C)C=CC(=O)[C@@]32CO[C@@]1(O)[C@]12[C@H]3CC[C@H](C1)C(=C)[C@H]2OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Odonicin is a compound isolated from the aerial parts of Rabdosia longituba[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 545.7±50.0 °C at 760 mmHg |
| Flash Point | 182.8±23.6 °C |
| Exact Mass | 430.199158 |
| PSA | 99.13000 |
| LogP | 2.95 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |