Home
Products
Tirucallol
| Product Name | Tirucallol |
| Price: | $146 / 5mg |
| Catalog No.: | CN07396 |
| CAS No.: | 514-46-5 |
| Molecular Formula: | C30H50O |
| Molecular Weight: | 426.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Euphorbia ebracteolata Hayata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@@H]([C@@H]1CC[C@]2([C@@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tirucallol, a tetracyclic triterpene, is isolated from Euphorbia lacteal latex. Tirucallol has topical anti-inflammatory effect. Tirucallol can suppress ear edema in the mouse model and inhibit nitrite production in lipopolysaccharide-stimulated macrophages[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 498.9±44.0 °C at 760 mmHg |
| Flash Point | 221.1±20.7 °C |
| Exact Mass | 426.386169 |
| PSA | 20.23000 |
| LogP | 11.00 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |