Home
Products
Abietic acid
| Product Name | Abietic acid |
| Price: | $31 / 20mg |
| Catalog No.: | CN08515 |
| CAS No.: | 514-10-3 |
| Molecular Formula: | C20H30O2 |
| Molecular Weight: | 302.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Pinus massoniana. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C1=CC2=CCC3[C@]([C@H]2CC1)(C)CCC[C@@]3(C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Abietic acid, a diterpene isolated from Pimenta racemosa var. grissea, possesses antiproliferative, antibacterial, and anti-obesity properties. Abietic acid inhibits lipoxygenase activity for allergy treatment[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 439.5±44.0 °C at 760 mmHg |
| Flash Point | 208.1±23.1 °C |
| Exact Mass | 302.224579 |
| PSA | 37.30000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |