Home
Products
6,8-Diprenylgenistein
| Product Name | 6,8-Diprenylgenistein |
| Price: | Inquiry |
| Catalog No.: | CN04956 |
| CAS No.: | 51225-28-6 |
| Molecular Formula: | C25H26O5 |
| Molecular Weight: | 406.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Lupinus mutabilis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)c(CC=C(C)C)c2c(c1O)c(=O)c(co2)c1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 627.4±55.0 °C at 760 mmHg |
| Flash Point | 214.6±25.0 °C |
| Exact Mass | 406.178009 |
| PSA | 90.90000 |
| LogP | 7.14 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |