Home
Products
Yamogenin
| Product Name | Yamogenin |
| Price: | $351 / 10mg |
| Catalog No.: | CN02288 |
| CAS No.: | 512-06-1 |
| Molecular Formula: | C27H42O3 |
| Molecular Weight: | 414.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Dioscorea collettii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1CCC2(OC1)OC1C(C2C)C2(C(C1)C1CC=C3C(C1CC2)(C)CCC(C3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Yamogenin (Neodiosgenin) is a diastereomer of diosgenin. Yamogenin (Neodiosgenin) antagonizes the activation of the liver X receptor (LXR) in luciferase ligand assay. Yamogenin (Neodiosgenin) inhibits triacylglyceride (TG) accumulation through the suppression of gene expression of fatty acid synthesis in HepG2 hepatocytes[1]. |
| Target | IC50: TG accumulation; liver X receptor (LXR)[1] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 527.1±50.0 °C at 760 mmHg |
| Flash Point | 272.6±30.1 °C |
| Exact Mass | 414.313385 |
| PSA | 38.69000 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | -20℃ |