Home
Products
Diosgenin
| Product Name | Diosgenin |
| Price: | $12 / 20mg |
| Catalog No.: | CN02592 |
| CAS No.: | 512-04-9 |
| Molecular Formula: | C27H42O3 |
| Molecular Weight: | 414.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Dioscorea zingiberensis C.H.Wright |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C[C@@H]1CC[C@@]2(OC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC=C3[C@]([C@H]1CC2)(C)CC[C@@H](C3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Diosgenin, a steroidal saponin, can inhibit STAT3 signaling pathway. |
| Target | STAT3 |
| In Vitro | In MC65 cells, a cellular AD model, diosgenin exhibited weak protective abilities at 1 μM, may represent a good candidate as a steroidal moiety in our bivalent compounds against AD pathology[1]. Diosgenin inhibits the constitutive activation of STAT3 in C3A cells in a dose-dependent manner, with maximum inhibition occurring at around 100 μM[2]. |
| In Vivo | Diosgenin treatment significantly reduces fasted and refed blood glucose level in HF dietfed mice. Diosgenin treatment significantly reduces blood glucose level in IPGTT test, compared with that of HF diet-fed mice[3]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 527.1±50.0 °C at 760 mmHg |
| Flash Point | 272.6±30.1 °C |
| Exact Mass | 414.313385 |
| PSA | 38.69000 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | Refrigerator |