Home
Products
Glucotropaeolin
| Product Name | Glucotropaeolin |
| Price: | $467 / 5mg |
| Catalog No.: | CN06392 |
| CAS No.: | 5115-71-9 |
| Molecular Formula: | C14H18KNO9S2 |
| Molecular Weight: | 447.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The herbs of Tropaeolum majus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(S/C(=N/OS(=O)(=O)[O-])/Cc2ccccc2)C(C(C1O)O)O.[K+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glucotropaeolin potassium (Benzylglucosinolate potassium) , a glucosinolate contained in cruciferous vegetables, causes a moderate decrease in spontaneous DNA damage in animals[1]. |
| Exact Mass | 447.006012 |
| PSA | 202.62000 |