Home
Products
Totarol
| Product Name | Totarol |
| Price: | Inquiry |
| Catalog No.: | CN08706 |
| CAS No.: | 511-15-9 |
| Molecular Formula: | C20H30O |
| Molecular Weight: | 286.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Podocarpus totara |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(c1c(O)ccc2c1CC[C@@H]1[C@]2(C)CCCC1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Totarol is a diterpenoid compound isolated from Podocarpus spp.. (+)-Totarol is a potent antioxidant and antibacterial agent[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 346.1±37.0 °C at 760 mmHg |
| Flash Point | 163.0±15.1 °C |
| Exact Mass | 284.250397 |
| PSA | 20.23000 |
| LogP | 8.76 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |