Home
Products
Wogonoside
| Product Name | Wogonoside |
| Price: | $65 / 20mg |
| Catalog No.: | CN05510 |
| CAS No.: | 51059-44-0 |
| Molecular Formula: | C22H20O11 |
| Molecular Weight: | 460.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Scutellaria baicalensis Georgi. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1c(O[C@@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)cc(c2c1oc(cc2=O)c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Wogonoside, a flavonoid glycoside isolated from Huangqin, possesses anti-inflammatory effects. Wogonoside induces autophagy in breast cancer cells by regulating MAPK-mTOR pathway[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 869.0±65.0 °C at 760 mmHg |
| Flash Point | 304.0±27.8 °C |
| Exact Mass | 460.100555 |
| PSA | 176.12000 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | ?20°C |