Home
Products
6''-O-Malonylgenistin
| Product Name | 6''-O-Malonylgenistin |
| Price: | $497 / 5mg |
| Catalog No.: | CN04906 |
| CAS No.: | 51011-05-3 |
| Molecular Formula: | C24H22O13 |
| Molecular Weight: | 518.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max (L.) Merr |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)CC(=O)OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)occ(c3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6''-O-Malonylgenistin(Malonylgenistin) is an isoflavone derivative. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 880.2±65.0 °C at 760 mmHg |
| Flash Point | 302.0±27.8 °C |
| Exact Mass | 518.106018 |
| PSA | 213.42000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | Store at -20 |