Home
Products
Minecoside
| Product Name | Minecoside |
| Price: | Inquiry |
| Catalog No.: | CN03142 |
| CAS No.: | 51005-44-8 |
| Molecular Formula: | C25H30O13 |
| Molecular Weight: | 538.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The barks of Kigelia pinnata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)/C=C/c2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Minecoside is a CXCR4/STAT3 inhibitor with anticancer and anti-inflammatory activity. Minecoside decreases CXCR4 expression and suppresses STAT3 activation, thus to inhibit CXCL 12-induced invasion. Minecoside potently inhibits cancer metastasis and promotes apoptotic progression[1][2]. |
| Target | CXCR4; STAT3 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 815.9±65.0 °C at 760 mmHg |
| Flash Point | 275.7±27.8 °C |
| Exact Mass | 538.168640 |
| PSA | 197.13000 |
| LogP | -2.66 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | ?20°C |