Home
Products
Atropine
| Product Name | Atropine |
| Price: | Inquiry |
| Catalog No.: | CN01940 |
| CAS No.: | 51-55-8 |
| Molecular Formula: | C17H23NO3 |
| Molecular Weight: | 289.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Atropa belladonna L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC(c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)N2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atropine is a medication used to treat certain types of nerve agent and pesticide poisonings, some types of slow heart rate, and to decrease saliva production during surgery. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 429.8±45.0 °C at 760 mmHg |
| Flash Point | 213.7±28.7 °C |
| Exact Mass | 289.167786 |
| PSA | 49.77000 |
| LogP | 1.53 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |