Home
Products
Norepinephrine
| Product Name | Norepinephrine |
| Price: | Inquiry |
| Catalog No.: | CN01980 |
| CAS No.: | 51-41-2 |
| Molecular Formula: | C8H11NO3 |
| Molecular Weight: | 169.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From the adrenal gland of Pig. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NC[C@@H](c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Norepinephrine is a peripheral vasoconstrictor by acting on alpha-adrenergic receptors. |
| Target | Human Endogenous Metabolite |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 442.6±40.0 °C at 760 mmHg |
| Flash Point | 221.5±27.3 °C |
| Exact Mass | 169.073898 |
| PSA | 86.71000 |
| LogP | -0.88 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8°C |