Home
Products
Arteannuin B
| Product Name | Arteannuin B |
| Price: | $146 / 10mg |
| Catalog No.: | CN09422 |
| CAS No.: | 50906-56-4 |
| Molecular Formula: | C15H20O3 |
| Molecular Weight: | 248.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia annua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1O[C@@]23[C@H](C1=C)CC[C@H]([C@@H]2CC[C@@]1([C@H]3O1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arteannuin B co-occurs with artemisinin, which is the potent antimalarial principle of the Chinese medicinal herb Artemisia annua (Asteraceae)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 398.7±35.0 °C at 760 mmHg |
| Flash Point | 168.5±20.5 °C |
| Exact Mass | 248.141251 |
| PSA | 38.83000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |