Home
Products
12-alpha-Hydroxyrotenone
| Product Name | 12-alpha-Hydroxyrotenone |
| Price: | Inquiry |
| Catalog No.: | CN04235 |
| CAS No.: | 509-96-6 |
| Molecular Formula: | C23H22O7 |
| Molecular Weight: | 410.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Derris trifoliata Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OC)OC[C@@H]1[C@@]2(O)C(=O)c2c(O1)c1C[C@@H](Oc1cc2)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rotenolone is an antiproliferative agent. Rotenolone shows antiproliferative activity against the ovarian cancer A2780, breast cancer BT-549, prostate cancer DU 145, NSCLC NCI-H460, and colon cancer HCC-2998 cell lines, with IC50s of 0.95, 1.6, 2.7, 2.0, and 2.9 μM, respectively[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 623.1±55.0 °C at 760 mmHg |
| Flash Point | 219.2±25.0 °C |
| Exact Mass | 410.136566 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | -20°C |