Home
Products
Mitraphylline
| Product Name | Mitraphylline |
| Price: | $169 / 10mg |
| Catalog No.: | CN00751 |
| CAS No.: | 509-80-8 |
| Molecular Formula: | C21H24N2O4 |
| Molecular Weight: | 368.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Uncaria rhynchophylla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)C1=CO[C@H]([C@@H]2[C@@H]1C[C@@H]1N(C2)CC[C@@]21C(=O)Nc1c2cccc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mitraphylline is the major pentacyclic oxindolic alkaloid presented in Uncaria tomentosa. Mitraphylline inhibits lipopolysaccharide-mediated activation of primary human neutrophils[1]. |
| Density | 1.33 g/cm3 |
| Boiling Point | 555.2ºC |
| Flash Point | 289.6ºC |
| Exact Mass | 368.17400 |
| PSA | 67.87000 |
| LogP | 2.13840 |