Home
Products
Delsoline
| Product Name | Delsoline |
| Price: | Inquiry |
| Catalog No.: | CN02024 |
| CAS No.: | 509-18-2 |
| Molecular Formula: | C25H41NO7 |
| Molecular Weight: | 467.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2[C@H](OC)C(C3N(C1)CC)(O)[C@@]1([C@@H]2[C@H]4C[C@@H]([C@@H]2OC)[C@H](C1)OC)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Delsoline, a major alkaloid of Delphinium anthriscifolium Hance, has both a curare-like effect and a ganglion-blocking effect and is used to relieve muscle tension or hyperkinesia. D. anthriscifolium Hance has effects of dispelling wind and dampness, activating collaterals, and relieving pains and is used to treat rheumatism, hemiplegia, indigestion, and cough[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 576.0±50.0 °C at 760 mmHg |
| Flash Point | 302.1±30.1 °C |
| Exact Mass | 467.288300 |
| PSA | 100.85000 |
| LogP | -0.27 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Storage condition | 2-8C |