Home
Products
1-Acetyl-beta-carboline
| Product Name | 1-Acetyl-beta-carboline |
| Price: | $584 / 5mg |
| Catalog No.: | CN01273 |
| CAS No.: | 50892-83-6 |
| Molecular Formula: | C13H10N2O |
| Molecular Weight: | 210.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Picrasma quassioides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)c1nccc2c1[nH]c1c2cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-Acetyl-β-carboline is metabolite of streptomyces kasugaensis[1]. |
| Density | 1.3±0.1g/cm3 |
| Boiling Point | 438.2±25.0°C at 760 mmHg |
| Flash Point | 219.3±29.6°C |
| Exact Mass | 210.07900 |
| PSA | 45.75000 |
| LogP | 2.91870 |
| Storage condition | -20°C |