Home
Products
Neoliquiritin
| Product Name | Neoliquiritin |
| Price: | $293 / 10mg |
| Catalog No.: | CN04766 |
| CAS No.: | 5088-75-5 |
| Molecular Formula: | C21H22O9 |
| Molecular Weight: | 418.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)O[C@@H](CC3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoliquiritin is isolated from Glycyrrhiza uralensis with an anti-inflammatory activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 746.8±60.0 °C at 760 mmHg |
| Flash Point | 265.9±26.4 °C |
| Exact Mass | 418.126373 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |