Home
Products
Polyphyllin B
| Product Name | Polyphyllin B |
| Price: | $103 / 20mg |
| Catalog No.: | CN02425 |
| CAS No.: | 50773-42-7 |
| Molecular Formula: | C51H82O20 |
| Molecular Weight: | 1015.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Paris yunnanensis Franch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3[C@H](C)[C@]3(O4)CC[C@H](CO3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Formosanin C is a diosgenin saponin isolated from Paris formosana Hayata and an immunomodulator with antitumor activity. Formosanin C induces apoptosis[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 1014.539917 |
| PSA | 294.60000 |
| LogP | 5.72 |
| Storage condition | -20°C |