Home
Products
Niranthin
| Product Name | Niranthin |
| Price: | Inquiry |
| Catalog No.: | CN02936 |
| CAS No.: | 50656-77-4 |
| Molecular Formula: | C24H32O7 |
| Molecular Weight: | 432.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Phyllanthus amarus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@@H]([C@@H](Cc1ccc(c(c1)OC)OC)COC)Cc1cc(OC)c2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Niranthin, a lignan with a wide spectrum of pharmacological activities. Niranthin is a potent and non-competitive inhibitor of heterodimeric type IB topoisomerase of L. donovani. Niranthin can be used for the research of drug-resistant leishmaniasis treatment[1]. |
| Target | Topoisomerase |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 559.5±50.0 °C at 760 mmHg |
| Flash Point | 221.8±30.0 °C |
| Exact Mass | 432.214813 |
| PSA | 64.61000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |