Home
Products
Arachidonic acid
| Product Name | Arachidonic acid |
| Price: | $92 / 20mg |
| Catalog No.: | CN06670 |
| CAS No.: | 506-32-1 |
| Molecular Formula: | C20H32O2 |
| Molecular Weight: | 304.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arachidonic acid is an essential fatty acid and a major constituent of biomembranes. |
| Target | Human Endogenous Metabolite |
| In Vivo | Arachidonic acid (ARA) is converted into various lipid mediators, such as prostaglandin E2 (PGE2), which is involved in the development of rheumatoid arthritis (RA)[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 407.5±0.0 °C at 760 mmHg |
| Flash Point | 336.3±18.0 °C |
| Exact Mass | 304.240234 |
| PSA | 37.30000 |
| LogP | 6.91 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |