Home
Products
Aloe-emodin-3-(hydroxymethyl)-O-beta-D-glucopyranoside
| Product Name | Aloe-emodin-3-(hydroxymethyl)-O-beta-D-glucopyranoside |
| Price: | $351 / 5mg |
| Catalog No.: | CN05863 |
| CAS No.: | 50488-89-6 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The herbs of Rheum officinale |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCc2cc(O)c3c(c2)C(=O)c2c(C3=O)c(O)ccc2)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aloe-emodin-3-(hydroxymethyl)-O-β-D-glucopyranoside (Aloe-emodin 3-O-β-D-glucoside) is a natural antraquinone[1]. |
| Density | 1.72±0.1 g/cm3(Predicted) |
| Boiling Point | 756.5±60.0 °C(Predicted) |
| Exact Mass | 432.10600 |
| PSA | 173.98000 |