Home
Products
Isorhamnetin-3-O-beta-D-Glucoside
| Product Name | Isorhamnetin-3-O-beta-D-Glucoside |
| Price: | $249 / 10mg |
| Catalog No.: | CN05491 |
| CAS No.: | 5041-82-7 |
| Molecular Formula: | C22H22O12 |
| Molecular Weight: | 478.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Typha orientalis Presl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorhamnetin-3-O-glucoside, a natural compound widely contained in many vegetables and rice, could be metabolized in intestinal microbiota after digestion[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 834.4±65.0 °C at 760 mmHg |
| Flash Point | 291.3±27.8 °C |
| Exact Mass | 478.111115 |
| PSA | 199.51000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8C |