Home
Products
Isoliquiritin
| Product Name | Isoliquiritin |
| Price: | $117 / 20mg |
| Catalog No.: | CN05703 |
| CAS No.: | 5041-81-6 |
| Molecular Formula: | C21H22O9 |
| Molecular Weight: | 418.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)/C=C/C(=O)c2ccc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoliquiritin, isolated from Licorice Root, inhibits angiogenesis and tube formation. Isoliquiritin also exhibits antidepressant-like effects and antifungal activity[1][2][3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 743.5±60.0 °C at 760 mmHg |
| Flash Point | 263.3±26.4 °C |
| Exact Mass | 418.126373 |
| PSA | 156.91000 |
| LogP | 0.76 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |