Home
Products
8-Azabicyclo-3.2.1-octan-3-ol
| Product Name | 8-Azabicyclo-3.2.1-octan-3-ol |
| Price: | Inquiry |
| Catalog No.: | CN01772 |
| CAS No.: | 501-33-7 |
| Molecular Formula: | C7H13NO |
| Molecular Weight: | 127.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The fruit of Morus alba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@H]2CC[C@@H](C1)N2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 127.10000 |
| PSA | 32.26000 |
| LogP | 0.59050 |