Home
Products
Ascorbic acid
| Product Name | Ascorbic acid |
| Price: | $15 / 20mg |
| Catalog No.: | CN06674 |
| CAS No.: | 50-81-7 |
| Molecular Formula: | C6H8O8 |
| Molecular Weight: | 176.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Ziziphus jujuba Mill. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]([C@H]1OC(=O)C(=C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Ascorbic acid is an effective reducing agent and donor antioxidant. |
| Density | 2.0±0.1 g/cm3 |
| Boiling Point | 552.7±50.0 °C at 760 mmHg |
| Flash Point | 238.2±23.6 °C |
| Exact Mass | 176.032089 |
| PSA | 107.22000 |
| LogP | -2.41 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |