Home
Products
Corticosterone
| Product Name | Corticosterone |
| Price: | $37 / 20mg |
| Catalog No.: | CN02517 |
| CAS No.: | 50-22-6 |
| Molecular Formula: | C21H30O4 |
| Molecular Weight: | 346.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC(=O)[C@H]1CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corticosterone is an adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. |
| Target | Human Endogenous Metabolite |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 529.2±50.0 °C at 760 mmHg |
| Flash Point | 288.0±26.6 °C |
| Exact Mass | 346.214417 |
| PSA | 74.60000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | Store at RT |