Home
Products
Ergocalciferol
| Product Name | Ergocalciferol |
| Price: | $31 / 20mg |
| Catalog No.: | CN06673 |
| CAS No.: | 50-14-6 |
| Molecular Formula: | C28H44O |
| Molecular Weight: | 396.65 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From the edible mushroom Cantharelluscibarius (chanterelle). |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CCC(=C)/C(=C/C=C/2CCC[C@]3(C2CC[C@@H]3[C@@H](/C=C/[C@@H](C(C)C)C)C)C)/C1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vitamin D2 (Ergocalciferol) is a form of vitamin D, used as a vitamin D supplement. Target: Ergocalciferol is a secosteroid formed by a photochemical bond breaking of a steroid, specifically, by the action of ultraviolet light on ergosterol. |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 504.2±29.0 °C at 760 mmHg |
| Flash Point | 218.2±16.5 °C |
| Exact Mass | 396.339203 |
| PSA | 20.23000 |
| LogP | 9.56 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2~8 °C |