Home
Products
Isomaltose
| Product Name | Isomaltose |
| Price: | $28 / 20mg |
| Catalog No.: | CN06336 |
| CAS No.: | 499-40-1 |
| Molecular Formula: | C12H22O11 |
| Molecular Weight: | 342.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Triticum aestivum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1O[C@H](OCC2OC(O)C([C@H]([C@@H]2O)O)O)C([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isomaltose is composed of two glucose units and suitable as a non-cariogenic sucrose replacement and is favorable in products for diabetics and prediabetic dispositions. |
| Target | Human Endogenous Metabolite |
| Density | 1.68±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 774.5±60.0 °C at 760 mmHg |
| Flash Point | 288.9±26.4 °C |
| Exact Mass | 342.116211 |
| PSA | 189.53000 |
| LogP | -4.34 |
| Vapour Pressure | 0.0±6.0 mmHg at 25°C |
| Storage condition | 2-8°C |