Home
Products
Dhurrin
| Product Name | Dhurrin |
| Price: | Inquiry |
| Catalog No.: | CN00592 |
| CAS No.: | 499-20-7 |
| Molecular Formula: | C14H17NO7 |
| Molecular Weight: | 311.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Sorghum bicolor |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H](c2ccc(cc2)O)C#N)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.56g/cm3 |
| Boiling Point | 586.7ºC at 760 mmHg |
| Flash Point | 308.6ºC |
| Exact Mass | 311.10100 |
| PSA | 143.40000 |