Home
Products
Arbutin
| Product Name | Arbutin |
| Price: | $15 / 20mg |
| Catalog No.: | CN04111 |
| CAS No.: | 497-76-7 |
| Molecular Formula: | C12H16O7 |
| Molecular Weight: | 272.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | White powder |
| Source: | The leaves of Arctostaphylos uvaursi |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arbutin(β-Arbutin) is a glycoside; a glycosylated hydroquinone extracted from the bearberry plant in the genus Arctostaphylos; inhibits tyrosinase and thus prevents the formation of melanin.IC50 value:Target: tyrosinase |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 561.6±50.0 °C at 760 mmHg |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 272.089600 |
| PSA | 119.61000 |
| LogP | -1.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |