Home
Products
L-(+)-Ergothioneine
| Product Name | L-(+)-Ergothioneine |
| Price: | $40 / 20mg |
| Catalog No.: | CN06357 |
| CAS No.: | 497-30-3 |
| Molecular Formula: | C9H15N3O2S |
| Molecular Weight: | 229.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | From Boletus edulis Bull. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | [O-]C(=O)[C@@H]([N+](C)(C)C)Cc1c[nH]c(=S)[nH]1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ergothioneine, an imidazole-2-thione derivative of histidine betaine, is synthesized by certain bacteria and fungi. Ergothioneine is generally considered an antioxidant[1]. |
| Exact Mass | 229.088501 |
| PSA | 100.97000 |
| LogP | -3.43 |
| Storage condition | -20°C |