Home
Products
Angelicain
| Product Name | Angelicain |
| Price: | Inquiry |
| Catalog No.: | CN05335 |
| CAS No.: | 49624-66-0 |
| Molecular Formula: | C15H16O6 |
| Molecular Weight: | 292.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica sinensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCc1cc(=O)c2c(o1)cc1c(c2O)C[C@H](O1)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Angelicain (Norcimifugin) is a constituent of Cimicifuga foetida with anti-inflammatory activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 534.1±50.0 °C at 760 mmHg |
| Flash Point | 203.4±23.6 °C |
| Exact Mass | 292.094696 |
| PSA | 100.13000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |