Home
Products
Nodakenetin
| Product Name | Nodakenetin |
| Price: | $146 / 10mg |
| Catalog No.: | CN06254 |
| CAS No.: | 495-32-9 |
| Molecular Formula: | C14H14O4 |
| Molecular Weight: | 246.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Peucedanum decursivum Maxim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)cc1c(c2)CC(O1)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nodakenetin, isolated from Angelica decursiva, possesses antioxidant anti-inflammatory activities. Nodakenetin has the potential to be an antiarthritic and nerve tonic[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 434.0±45.0 °C at 760 mmHg |
| Flash Point | 168.0±22.2 °C |
| Exact Mass | 246.089203 |
| PSA | 59.67000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8℃ |