Home
Products
Ammijin
| Product Name | Ammijin |
| Price: | Inquiry |
| Catalog No.: | CN06169 |
| CAS No.: | 495-30-7 |
| Molecular Formula: | C20H24O9 |
| Molecular Weight: | 408.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Ammi majus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC(C2Oc3c(C2)cc2c(c3)oc(=O)cc2)(C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Marmesinin ((-)-Marmesinin), a natural coumarin, is a biosynthetic precursor of psoralen and linear furanocoumarins. Marmesinin exhibits significant neuroprotective activities against glutamate-induced toxicity[1][2]. |
| Exact Mass | 408.14200 |
| PSA | 138.82000 |