Home
Products
Auraptene
| Product Name | Auraptene |
| Price: | $117 / 10mg |
| Catalog No.: | CN06255 |
| CAS No.: | 495-02-3 |
| Molecular Formula: | C19H22O3 |
| Molecular Weight: | 298.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The peels of Poncirus trifoliata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCOc1ccc2c(c1)oc(=O)cc2)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Auraptene is the most abundant naturally occurring geranyloxycoumarin. Auraptene is primarily isolated from plants in the Rutaceae family, such as citrus fruits. Auraptene decreases the secretion of matrix metalloproteinase 2 (MMP-2) as well as key inflammatory mediators, including IL-6, IL-8, and chemokine (C-C motif) ligand-5(CCL5)[1]. |
| Target | MMP-2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 455.5±45.0 °C at 760 mmHg |
| Flash Point | 195.4±23.3 °C |
| Exact Mass | 298.156891 |
| PSA | 39.44000 |
| LogP | 5.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | ?20°C |