Home
Products
Glucovanillin
| Product Name | Glucovanillin |
| Price: | $103 / 20mg |
| Catalog No.: | CN03224 |
| CAS No.: | 494-08-6 |
| Molecular Formula: | C14H18O8 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Vanilla planifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2OC)C=O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glucovanillin extracted from green pods and simultaneously transformed to vanillin by a combination of enzyme activities involving cell wall degradation and glucovanillin hydrolysis. |
| Density | 1.481g/cm3 |
| Boiling Point | 574.7ºC at 760 mmHg |
| Flash Point | 216.6ºC |
| Exact Mass | 314.10000 |
| PSA | 125.68000 |
| Vapour Pressure | 4.75E-14mmHg at 25°C |
| Storage condition | 2-8°C |