Home
Products
7-Hydroxyflavonol
| Product Name | 7-Hydroxyflavonol |
| Price: | Inquiry |
| Catalog No.: | CN04312 |
| CAS No.: | 492-00-2 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Atraphaxis pyrifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)oc(c(c2=O)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.443g/cm3 |
| Boiling Point | 495.3ºC at 760 mmHg |
| Flash Point | 193.9ºC |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |
| Vapour Pressure | 6.55E-10mmHg at 25°C |