Home
Products
5-Hydroxyflavone
| Product Name | 5-Hydroxyflavone |
| Price: | $92 / 20mg |
| Catalog No.: | CN04385 |
| CAS No.: | 491-78-1 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The stem barks of Garcinia malaccensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cccc2c1c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Hydroxyflavone, a flavonoid ligand, shows no cytotoxic activity against MCF-7, FaDU, MDA-MB-435S, U87, RPE-1, and HEK293 cells[1]. |
| Density | 1.34g/cm3 |
| Boiling Point | 425ºC at 760 mmHg |
| Flash Point | 165.4ºC |
| Exact Mass | 238.06300 |
| PSA | 50.44000 |
| LogP | 3.16560 |
| Vapour Pressure | 7.97E-08mmHg at 25°C |