Home
Products
Iridin
| Product Name | Iridin |
| Price: | $92 / 10mg |
| Catalog No.: | CN04678 |
| CAS No.: | 491-74-7 |
| Molecular Formula: | C24H26O13 |
| Molecular Weight: | 522.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Iris germanica. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3occ(c(=O)c3c(c2OC)O)c2cc(O)c(c(c2)OC)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Iridin is an isoflavone isolated from Iris milesii[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 833.5±65.0 °C at 760 mmHg |
| Flash Point | 284.1±27.8 °C |
| Exact Mass | 522.137329 |
| PSA | 197.74000 |
| LogP | -0.08 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |