Home
Products
Chrysoeriol
| Product Name | Chrysoeriol |
| Price: | $190 / 5mg |
| Catalog No.: | CN05336 |
| CAS No.: | 491-71-4 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 300.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Medicago sativa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)c1cc(=O)c2c(o1)cc(cc2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chrysoeriol, a natural flavonoid extracted from the tropical plant Coronopus didymus, exhibits potent antioxidant activity. Chrysoeriol shows significant inhibition of lipid peroxidation[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 574.3±50.0 °C at 760 mmHg |
| Flash Point | 219.4±23.6 °C |
| Exact Mass | 300.063385 |
| PSA | 100.13000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8C |