Home
Products
Isogentisin
| Product Name | Isogentisin |
| Price: | Inquiry |
| Catalog No.: | CN05716 |
| CAS No.: | 491-64-5 |
| Molecular Formula: | C14H10O5 |
| Molecular Weight: | 258.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Gentiana lutea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)c(=O)c1c(o2)cc(cc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.48g/cm3 |
| Boiling Point | 519.4ºC at 760 mmHg |
| Flash Point | 205ºC |
| Exact Mass | 258.05300 |
| PSA | 79.90000 |
| LogP | 2.36600 |
| Vapour Pressure | 2.09E-11mmHg at 25°C |