Home
Products
Kaempferide
| Product Name | Kaempferide |
| Price: | $46 / 20mg |
| Catalog No.: | CN05339 |
| CAS No.: | 491-54-3 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 300.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Kaempferia galangal L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferide is an O-methylated flavonol, a type of chemical compound. It can be found in Kaempferia galanga (aromatic ginger). The enzyme kaempferol 4'-O-methyltransferase uses S-adenosyl-L-methionine and kaempferol to produce S-adenosyl-L-homocysteine and kaempferide. P-glycoproteins. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 543.8±50.0 °C at 760 mmHg |
| Flash Point | 207.1±23.6 °C |
| Exact Mass | 300.063385 |
| PSA | 100.13000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8°C |