Home
Products
Quercetin-7-O-beta-D-glucopyranoside
| Product Name | Quercetin-7-O-beta-D-glucopyranoside |
| Price: | $176 / 10mg |
| Catalog No.: | CN05486 |
| CAS No.: | 491-50-9 |
| Molecular Formula: | C21H20O12 |
| Molecular Weight: | 464.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Rostellularia procumbens |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(c(c3=O)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercimeritrin, isolated from the leaves of Ixeridium dentatum, exhibits significant amylase activity[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 859.2±65.0 °C at 760 mmHg |
| Flash Point | 302.8±27.8 °C |
| Exact Mass | 464.095490 |
| PSA | 210.51000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8C |